C31H42O12 — CID 44661104
4-[[(10R,13R)-3-(3-carboxypropanoyloxy)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methoxy]-4-oxobutanoic acid (PubChem CID 44661104) has the molecular formula C31H42O12 and a molecular weight of 606.67 g/mol. Its IUPAC name is 4-[[(10R,13R)-3-(3-carboxypropanoyloxy)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(10R,13R)-3-(3-carboxypropanoyloxy)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 44661104 |
| Molecular Formula | C31H42O12 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | 4-[[(10R,13R)-3-(3-carboxypropanoyloxy)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methoxy]-4-oxobutanoic acid |
| SMILES | C[C@]12CCC3C(CCC4(O)CC(OC(=O)CCC(=O)O)CC[C@]34COC(=O)CCC(=O)O)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C31H42O12/c1-28-10-7-21-22(31(28,40)13-9-20(28)18-14-27(38)41-16-18)8-12-30(39)15-19(43-26(37)5-3-24(34)35)6-11-29(21,30)17-42-25(36)4-2-23(32)33/h14,19-22,39-40H,2-13,15-17H2,1H3,(H,32,33)(H,34,35)/t19?,20?,21?,22?,28-,29+,30?,31?/m1/s1 |
| InChIKey | PORLQGCIBQPFNX-ZMOWJJMOSA-N |
| XLogP | 2.52 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|