C20H30O5 — CID 163133590
(1R,2S,5R,9R,10E,12R)-9-hydroxy-5,9-dimethyl-12-propan-2-yl-13,17-dioxatricyclo[10.2.2.12,5]heptadec-10-ene-6,14-dione (PubChem CID 163133590) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,2S,5R,9R,10E,12R)-9-hydroxy-5,9-dimethyl-12-propan-2-yl-13,17-dioxatricyclo[10.2.2.12,5]heptadec-10-ene-6,14-dione.
| Compound Name | (1R,2S,5R,9R,10E,12R)-9-hydroxy-5,9-dimethyl-12-propan-2-yl-13,17-dioxatricyclo[10.2.2.12,5]heptadec-10-ene-6,14-dione |
|---|---|
| PubChem CID | 163133590 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1R,2S,5R,9R,10E,12R)-9-hydroxy-5,9-dimethyl-12-propan-2-yl-13,17-dioxatricyclo[10.2.2.12,5]heptadec-10-ene-6,14-dione |
| SMILES | CC(C)[C@@]12/C=C\[C@](C)(O)CCC(=O)[C@@]3(C)CC[C@H](O3)[C@@H](CC1)C(=O)O2 |
| InChI | InChI=1S/C20H30O5/c1-13(2)20-10-5-14(17(22)25-20)15-6-9-19(4,24-15)16(21)7-8-18(3,23)11-12-20/h11-15,23H,5-10H2,1-4H3/b12-11-/t14-,15+,18-,19-,20+/m1/s1 |
| InChIKey | HBTAJGAWUIDLHK-DDBPUUHMSA-N |
| XLogP | 2.94 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|