C21H28N2 — CID 163133966
[(1R,2R,5S,6S)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methanidylazanium (PubChem CID 163133966) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is [(1R,2R,5S,6S)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methanidylazanium.
| Compound Name | [(1R,2R,5S,6S)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methanidylazanium |
|---|---|
| PubChem CID | 163133966 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | [(1R,2R,5S,6S)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methanidylazanium |
| SMILES | C=C[C@@]1(C)CC[C@H](C(=C)C)[C@@H](c2c[nH]c3ccccc23)[C@H]1[NH2+][CH2-] |
| InChI | InChI=1S/C21H28N2/c1-6-21(4)12-11-15(14(2)3)19(20(21)22-5)17-13-23-18-10-8-7-9-16(17)18/h6-10,13,15,19-20,23H,1-2,5,11-12,22H2,3-4H3/t15-,19+,20-,21+/m1/s1 |
| InChIKey | HFPPKKMNZRYBDC-QAJUQPOASA-N |
| XLogP | 4.15 |
| TPSA | 32.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|