C18H22N2O2 — CID 15656668
ethyl N-[(1S,2S,3R,4R)-3-(1H-indol-3-yl)-2-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 15656668) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is ethyl N-[(1S,2S,3R,4R)-3-(1H-indol-3-yl)-2-bicyclo[2.2.1]heptanyl]carbamate.
| Compound Name | ethyl N-[(1S,2S,3R,4R)-3-(1H-indol-3-yl)-2-bicyclo[2.2.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 15656668 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | ethyl N-[(1S,2S,3R,4R)-3-(1H-indol-3-yl)-2-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CCOC(=O)N[C@H]1[C@H]2CC[C@H](C2)[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H22N2O2/c1-2-22-18(21)20-17-12-8-7-11(9-12)16(17)14-10-19-15-6-4-3-5-13(14)15/h3-6,10-12,16-17,19H,2,7-9H2,1H3,(H,20,21)/t11-,12+,16-,17+/m1/s1 |
| InChIKey | VDDHHFWTKURUDL-AWBCAMRRSA-N |
| XLogP | 3.80 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |