C21H27N2- — CID 163133971
[(1S,2R,5R,6R)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methylazanide (PubChem CID 163133971) has the molecular formula C21H27N2- and a molecular weight of 307.46 g/mol. Its IUPAC name is [(1S,2R,5R,6R)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methylazanide.
| Compound Name | [(1S,2R,5R,6R)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methylazanide |
|---|---|
| PubChem CID | 163133971 |
| Molecular Formula | C21H27N2- |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | [(1S,2R,5R,6R)-2-ethenyl-6-(1H-indol-3-yl)-2-methyl-5-prop-1-en-2-ylcyclohexyl]-methylazanide |
| SMILES | C=C[C@@]1(C)CC[C@@H](C(=C)C)[C@H](c2c[nH]c3ccccc23)[C@@H]1[N-]C |
| InChI | InChI=1S/C21H27N2/c1-6-21(4)12-11-15(14(2)3)19(20(21)22-5)17-13-23-18-10-8-7-9-16(17)18/h6-10,13,15,19-20,23H,1-2,11-12H2,3-5H3/q-1/t15-,19+,20-,21-/m0/s1 |
| InChIKey | FAOKMPGVBVJGDE-ZFCZOSEKSA-N |
| XLogP | 5.80 |
| TPSA | 29.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|