C21H26FN3O3 — CID 163134982
(1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 163134982) has the molecular formula C21H26FN3O3 and a molecular weight of 387.46 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 163134982 |
| Molecular Formula | C21H26FN3O3 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | CN(CCc1ccccn1)[C@@H]1[C@@H]2OC[C@H](O2)[C@@H](NCc2ccc(F)cc2)[C@@H]1O |
| InChI | InChI=1S/C21H26FN3O3/c1-25(11-9-16-4-2-3-10-23-16)19-20(26)18(17-13-27-21(19)28-17)24-12-14-5-7-15(22)8-6-14/h2-8,10,17-21,24,26H,9,11-13H2,1H3/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | HPJDUOOCKMEFLG-HGJUEJDCSA-N |
| XLogP | 1.34 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |