C22H28N4O5 — CID 162796084
1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 162796084) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 162796084 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-[methyl(2-pyridin-2-ylethyl)amino]-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2[C@H](O)[C@H](N(C)CCc3ccccn3)[C@@H]3OC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C22H28N4O5/c1-26(12-10-14-5-3-4-11-23-14)19-20(27)18(17-13-30-21(19)31-17)25-22(28)24-15-6-8-16(29-2)9-7-15/h3-9,11,17-21,27H,10,12-13H2,1-2H3,(H2,24,25,28)/t17-,18+,19-,20-,21+/m0/s1 |
| InChIKey | FKCODJFTLYYIMU-HGJUEJDCSA-N |
| XLogP | 1.24 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |