C19H28N4O5 — CID 162796480
1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 162796480) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 162796480 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@H]2[C@H](O)[C@H](N3CCN(C)CC3)[C@@H]3OC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C19H28N4O5/c1-22-7-9-23(10-8-22)16-17(24)15(14-11-27-18(16)28-14)21-19(25)20-12-3-5-13(26-2)6-4-12/h3-6,14-18,24H,7-11H2,1-2H3,(H2,20,21,25)/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | VHCMTQOGZIGSED-FLXSYLCISA-N |
| XLogP | -0.08 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |