C24H29FN4O5 — CID 25314824
1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea (PubChem CID 25314824) has the molecular formula C24H29FN4O5 and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
|---|---|
| PubChem CID | 25314824 |
| Molecular Formula | C24H29FN4O5 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
| SMILES | COc1ccccc1N1CCN([C@H]2[C@@H]3OC[C@@H](O3)[C@@H](NC(=O)Nc3ccc(F)cc3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C24H29FN4O5/c1-32-18-5-3-2-4-17(18)28-10-12-29(13-11-28)21-22(30)20(19-14-33-23(21)34-19)27-24(31)26-16-8-6-15(25)7-9-16/h2-9,19-23,30H,10-14H2,1H3,(H2,26,27,31)/t19-,20-,21-,22+,23-/m1/s1 |
| InChIKey | GSVLDVIMAWYTPH-FWKCKQQBSA-N |
| XLogP | 1.63 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |