C16H22FN3O5 — CID 25314742
1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea (PubChem CID 25314742) has the molecular formula C16H22FN3O5 and a molecular weight of 355.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
|---|---|
| PubChem CID | 25314742 |
| Molecular Formula | C16H22FN3O5 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(1S,2S,3S,4R,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
| SMILES | COCCN[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NC(=O)Nc2ccc(F)cc2)[C@@H]1O |
| InChI | InChI=1S/C16H22FN3O5/c1-23-7-6-18-13-14(21)12(11-8-24-15(13)25-11)20-16(22)19-10-4-2-9(17)3-5-10/h2-5,11-15,18,21H,6-8H2,1H3,(H2,19,20,22)/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | BDMLIFQJKSBZED-ARILJUKYSA-N |
| XLogP | 0.04 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|