C17H22N4O5 — CID 162812369
1-(3-cyanophenyl)-3-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea (PubChem CID 162812369) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
|---|---|
| PubChem CID | 162812369 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]urea |
| SMILES | COCCN[C@@H]1[C@@H]2OC[C@H](O2)[C@@H](NC(=O)Nc2cccc(C#N)c2)[C@@H]1O |
| InChI | InChI=1S/C17H22N4O5/c1-24-6-5-19-14-15(22)13(12-9-25-16(14)26-12)21-17(23)20-11-4-2-3-10(7-11)8-18/h2-4,7,12-16,19,22H,5-6,9H2,1H3,(H2,20,21,23)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | XRCGGCWBYTYPPG-XFIYOXNOSA-N |
| XLogP | -0.23 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|