C19H30N4O5 — CID 28960603
1-[(1S,2S,3S,4R,5R)-4-[2-(dimethylamino)ethyl-methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(3-methoxyphenyl)urea (PubChem CID 28960603) has the molecular formula C19H30N4O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-4-[2-(dimethylamino)ethyl-methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-4-[2-(dimethylamino)ethyl-methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 28960603 |
| Molecular Formula | C19H30N4O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-4-[2-(dimethylamino)ethyl-methylamino]-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)N[C@H]2[C@H](O)[C@@H](N(C)CCN(C)C)[C@@H]3OC[C@H]2O3)c1 |
| InChI | InChI=1S/C19H30N4O5/c1-22(2)8-9-23(3)16-17(24)15(14-11-27-18(16)28-14)21-19(25)20-12-6-5-7-13(10-12)26-4/h5-7,10,14-18,24H,8-9,11H2,1-4H3,(H2,20,21,25)/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | AWCVAQLSOLRVQX-HSFUPAIVSA-N |
| XLogP | 0.16 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |