C20H27N3O6 — CID 162796696
methyl 1-[(1R,2S,3S,4S,5R)-3-hydroxy-2-(phenylcarbamoylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxylate (PubChem CID 162796696) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 1-[(1R,2S,3S,4S,5R)-3-hydroxy-2-(phenylcarbamoylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(1R,2S,3S,4S,5R)-3-hydroxy-2-(phenylcarbamoylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 162796696 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | methyl 1-[(1R,2S,3S,4S,5R)-3-hydroxy-2-(phenylcarbamoylamino)-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN([C@@H]2[C@@H]3OC[C@H](O3)[C@@H](NC(=O)Nc3ccccc3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C20H27N3O6/c1-27-18(25)12-7-9-23(10-8-12)16-17(24)15(14-11-28-19(16)29-14)22-20(26)21-13-5-3-2-4-6-13/h2-6,12,14-17,19,24H,7-11H2,1H3,(H2,21,22,26)/t14-,15+,16-,17-,19+/m0/s1 |
| InChIKey | VFGSJMJAKUPBMU-CNMWIUBYSA-N |
| XLogP | 0.55 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |