C18H25N3O6 — CID 163148720
1-[(1R,2R,3S,4R,5R)-3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 163148720) has the molecular formula C18H25N3O6 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-[(1R,2R,3S,4R,5R)-3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(1R,2R,3S,4R,5R)-3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 163148720 |
| Molecular Formula | C18H25N3O6 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1-[(1R,2R,3S,4R,5R)-3-hydroxy-4-morpholin-4-yl-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)N[C@@H]2[C@H](O)[C@@H](N3CCOCC3)[C@@H]3OC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C18H25N3O6/c1-24-12-4-2-11(3-5-12)19-18(23)20-14-13-10-26-17(27-13)15(16(14)22)21-6-8-25-9-7-21/h2-5,13-17,22H,6-10H2,1H3,(H2,19,20,23)/t13-,14-,15+,16-,17+/m0/s1 |
| InChIKey | MNYVHLIJXQYDAL-ZOFXXKQRSA-N |
| XLogP | 0.00 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |