C17H25N3O6 — CID 162828920
1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea (PubChem CID 162828920) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 162828920 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[(1R,2S,3S,4S,5R)-3-hydroxy-4-(2-methoxyethylamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-(4-methoxyphenyl)urea |
| SMILES | COCCN[C@@H]1[C@@H]2OC[C@H](O2)[C@@H](NC(=O)Nc2ccc(OC)cc2)[C@@H]1O |
| InChI | InChI=1S/C17H25N3O6/c1-23-8-7-18-14-15(21)13(12-9-25-16(14)26-12)20-17(22)19-10-3-5-11(24-2)6-4-10/h3-6,12-16,18,21H,7-9H2,1-2H3,(H2,19,20,22)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | WVJAZBWNFJQSAO-XFIYOXNOSA-N |
| XLogP | -0.09 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|