C18H24F3N3O4 — CID 25314644
1-[(1S,2S,3S,4R,5R)-4-(diethylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 25314644) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-4-(diethylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-4-(diethylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 25314644 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-4-(diethylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCN(CC)[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](NC(=O)Nc2cccc(C(F)(F)F)c2)[C@@H]1O |
| InChI | InChI=1S/C18H24F3N3O4/c1-3-24(4-2)14-15(25)13(12-9-27-16(14)28-12)23-17(26)22-11-7-5-6-10(8-11)18(19,20)21/h5-8,12-16,25H,3-4,9H2,1-2H3,(H2,22,23,26)/t12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | DMRIOZSYCBOUPF-DGXTUMSLSA-N |
| XLogP | 2.02 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |