C18H26N2O4 — CID 25338224
(1S,2S,3S,4R,5R)-2-[(4-methoxyphenyl)methylamino]-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 25338224) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-[(4-methoxyphenyl)methylamino]-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-[(4-methoxyphenyl)methylamino]-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 25338224 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-[(4-methoxyphenyl)methylamino]-4-pyrrolidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccc(CN[C@H]2[C@H](O)[C@@H](N3CCCC3)[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-22-13-6-4-12(5-7-13)10-19-15-14-11-23-18(24-14)16(17(15)21)20-8-2-3-9-20/h4-7,14-19,21H,2-3,8-11H2,1H3/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | QHUXYUCFGGXDRC-HSFUPAIVSA-N |
| XLogP | 0.73 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |