C20H29N3O5 — CID 28960500
1-[(1S,2S,3S,4R,5R)-3-hydroxy-2-[(4-methoxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide (PubChem CID 28960500) has the molecular formula C20H29N3O5 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[(1S,2S,3S,4R,5R)-3-hydroxy-2-[(4-methoxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[(1S,2S,3S,4R,5R)-3-hydroxy-2-[(4-methoxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28960500 |
| Molecular Formula | C20H29N3O5 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-[(1S,2S,3S,4R,5R)-3-hydroxy-2-[(4-methoxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN[C@H]2[C@H](O)[C@@H](N3CCC(C(N)=O)CC3)[C@@H]3OC[C@H]2O3)cc1 |
| InChI | InChI=1S/C20H29N3O5/c1-26-14-4-2-12(3-5-14)10-22-16-15-11-27-20(28-15)17(18(16)24)23-8-6-13(7-9-23)19(21)25/h2-5,13,15-18,20,22,24H,6-11H2,1H3,(H2,21,25)/t15-,16-,17-,18+,20-/m1/s1 |
| InChIKey | GRMXINZTMXDWTK-YFYQMDMQSA-N |
| XLogP | -0.16 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |