C19H27N3O5 — CID 74442661
1-[3-hydroxy-2-[(2-hydroxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide (PubChem CID 74442661) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[3-hydroxy-2-[(2-hydroxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[3-hydroxy-2-[(2-hydroxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74442661 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[3-hydroxy-2-[(2-hydroxyphenyl)methylamino]-6,8-dioxabicyclo[3.2.1]octan-4-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2C3OCC(O3)C(NCc3ccccc3O)C2O)CC1 |
| InChI | InChI=1S/C19H27N3O5/c20-18(25)11-5-7-22(8-6-11)16-17(24)15(14-10-26-19(16)27-14)21-9-12-3-1-2-4-13(12)23/h1-4,11,14-17,19,21,23-24H,5-10H2,(H2,20,25) |
| InChIKey | NAMJLSZEXJBDMC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|