C25H33N3O5 — CID 28960448
(1S,2S,3S,4R,5R)-2-[(2-methoxyphenyl)methylamino]-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 28960448) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-[(2-methoxyphenyl)methylamino]-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-[(2-methoxyphenyl)methylamino]-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 28960448 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-[(2-methoxyphenyl)methylamino]-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccccc1CN[C@H]1[C@H](O)[C@@H](N2CCN(c3ccccc3OC)CC2)[C@@H]2OC[C@H]1O2 |
| InChI | InChI=1S/C25H33N3O5/c1-30-19-9-5-3-7-17(19)15-26-22-21-16-32-25(33-21)23(24(22)29)28-13-11-27(12-14-28)18-8-4-6-10-20(18)31-2/h3-10,21-26,29H,11-16H2,1-2H3/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | VIUKOSWLHHEJOX-UUFXTFJOSA-N |
| XLogP | 1.47 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |