C18H26FN3O3 — CID 163181781
(1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 163181781) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 163181781 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (1R,2S,3S,4S,5R)-2-[(4-fluorophenyl)methylamino]-4-(4-methylpiperazin-1-yl)-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | CN1CCN([C@@H]2[C@@H]3OC[C@H](O3)[C@@H](NCc3ccc(F)cc3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-21-6-8-22(9-7-21)16-17(23)15(14-11-24-18(16)25-14)20-10-12-2-4-13(19)5-3-12/h2-5,14-18,20,23H,6-11H2,1H3/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | ZJYPCSGNRAODJB-FLXSYLCISA-N |
| XLogP | 0.02 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |