C18H26N2O3 — CID 25338162
(1S,2S,3S,4R,5R)-2-(benzylamino)-4-piperidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 25338162) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (1S,2S,3S,4R,5R)-2-(benzylamino)-4-piperidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,2S,3S,4R,5R)-2-(benzylamino)-4-piperidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 25338162 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1S,2S,3S,4R,5R)-2-(benzylamino)-4-piperidin-1-yl-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@H]1[C@H](NCc2ccccc2)[C@H]2CO[C@H](O2)[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-17-15(19-11-13-7-3-1-4-8-13)14-12-22-18(23-14)16(17)20-9-5-2-6-10-20/h1,3-4,7-8,14-19,21H,2,5-6,9-12H2/t14-,15-,16-,17+,18-/m1/s1 |
| InChIKey | WPKGTWHCOCLZLQ-HSFUPAIVSA-N |
| XLogP | 1.12 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |