C24H28F3N3O4 — CID 163051413
(1R,2S,3S,4S,5R)-4-(4-phenylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 163051413) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R)-4-(4-phenylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3S,4S,5R)-4-(4-phenylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 163051413 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (1R,2S,3S,4S,5R)-4-(4-phenylpiperazin-1-yl)-2-[[4-(trifluoromethoxy)phenyl]methylamino]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | O[C@H]1[C@H](NCc2ccc(OC(F)(F)F)cc2)[C@@H]2CO[C@H](O2)[C@H]1N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28F3N3O4/c25-24(26,27)34-18-8-6-16(7-9-18)14-28-20-19-15-32-23(33-19)21(22(20)31)30-12-10-29(11-13-30)17-4-2-1-3-5-17/h1-9,19-23,28,31H,10-15H2/t19-,20+,21-,22-,23+/m0/s1 |
| InChIKey | BIRAPERYYOWFBF-MFKCLSPESA-N |
| XLogP | 2.35 |
| TPSA | 66.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |