C42H52N2O5 — CID 163137422
20-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-7,14-dihydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 163137422) has the molecular formula C42H52N2O5 and a molecular weight of 664.89 g/mol. Its IUPAC name is 20-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-7,14-dihydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | 20-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-7,14-dihydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 163137422 |
| Molecular Formula | C42H52N2O5 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.39 |
| IUPAC Name | 20-[(6-amino-1,2-dihydropyridin-4-yl)methyl]-7,14-dihydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC1(C2CC(CC3=CCNC(N)=C3)CC3C#CC(c4ccccc4)c4cc(O)c(OC)cc4CCC(=O)C(O)C(=O)C3C2)CCCC1 |
| InChI | InChI=1S/C42H52N2O5/c1-3-16-42(17-7-8-18-42)32-22-28(20-27-15-19-44-39(43)23-27)21-30-11-13-33(29-9-5-4-6-10-29)34-26-37(46)38(49-2)24-31(34)12-14-36(45)41(48)40(47)35(30)25-32/h4-6,9-10,15,23-24,26,28,30,32-33,35,41,44,46,48H,3,7-8,12,14,16-22,25,43H2,1-2H3 |
| InChIKey | IMNBHJUVCCQENM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|