C36H44O4 — CID 162881430
7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162881430) has the molecular formula C36H44O4 and a molecular weight of 540.74 g/mol. Its IUPAC name is 7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | 7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162881430 |
| Molecular Formula | C36H44O4 |
| Molecular Weight | 540.74 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | 7-hydroxy-8-methoxy-4-phenyl-18-(1-propylcyclopentyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC1(C2CCCC3C#CC(c4ccccc4)c4cc(O)c(OC)cc4CCC(=O)CC(=O)C3C2)CCCC1 |
| InChI | InChI=1S/C36H44O4/c1-3-18-36(19-7-8-20-36)28-13-9-12-26-15-17-30(25-10-5-4-6-11-25)31-24-34(39)35(40-2)21-27(31)14-16-29(37)23-33(38)32(26)22-28/h4-6,10-11,21,24,26,28,30,32,39H,3,7-9,12-14,16,18-20,22-23H2,1-2H3 |
| InChIKey | VKAQMZAGWNBWAA-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.74 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|