C33H40O5 — CID 162872399
(1S,4R,16R,18R)-7-hydroxy-18-[(2S)-1-hydroxypentan-2-yl]-8-methoxy-4-phenyltricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162872399) has the molecular formula C33H40O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is (1S,4R,16R,18R)-7-hydroxy-18-[(2S)-1-hydroxypentan-2-yl]-8-methoxy-4-phenyltricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | (1S,4R,16R,18R)-7-hydroxy-18-[(2S)-1-hydroxypentan-2-yl]-8-methoxy-4-phenyltricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162872399 |
| Molecular Formula | C33H40O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | (1S,4R,16R,18R)-7-hydroxy-18-[(2S)-1-hydroxypentan-2-yl]-8-methoxy-4-phenyltricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCC[C@H](CO)[C@@H]1CCC[C@@H]2C#C[C@@H](c3ccccc3)c3cc(O)c(OC)cc3CCC(=O)CC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C33H40O5/c1-3-8-26(21-34)24-12-7-11-23-14-16-28(22-9-5-4-6-10-22)29-20-32(37)33(38-2)18-25(29)13-15-27(35)19-31(36)30(23)17-24/h4-6,9-10,18,20,23-24,26,28,30,34,37H,3,7-8,11-13,15,17,19,21H2,1-2H3/t23-,24-,26-,28+,30-/m1/s1 |
| InChIKey | NELXFOFEVIFMKO-ITZVIVGSSA-N |
| XLogP | 5.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|