C47H54N2O5 — CID 162792446
20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-18-(1-hydroxypentan-2-yl)-8-methoxy-4-phenyl-6-(2-phenylethyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162792446) has the molecular formula C47H54N2O5 and a molecular weight of 726.96 g/mol. Its IUPAC name is 20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-18-(1-hydroxypentan-2-yl)-8-methoxy-4-phenyl-6-(2-phenylethyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | 20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-18-(1-hydroxypentan-2-yl)-8-methoxy-4-phenyl-6-(2-phenylethyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162792446 |
| Molecular Formula | C47H54N2O5 |
| Molecular Weight | 726.96 g/mol |
| Exact Mass | 726.40 |
| IUPAC Name | 20-[(2-amino-4-pyridinyl)methyl]-7-hydroxy-18-(1-hydroxypentan-2-yl)-8-methoxy-4-phenyl-6-(2-phenylethyl)tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC(CO)C1CC(Cc2ccnc(N)c2)CC2C#CC(c3ccccc3)c3c(cc(OC)c(O)c3CCc3ccccc3)CCC(=O)CC(=O)C2C1 |
| InChI | InChI=1S/C47H54N2O5/c1-3-10-37(30-50)38-25-33(23-32-21-22-49-45(48)26-32)24-35-17-20-40(34-13-8-5-9-14-34)46-36(16-18-39(51)29-43(52)42(35)27-38)28-44(54-2)47(53)41(46)19-15-31-11-6-4-7-12-31/h4-9,11-14,21-22,26,28,33,35,37-38,40,42,50,53H,3,10,15-16,18-19,23-25,27,29-30H2,1-2H3,(H2,48,49) |
| InChIKey | ZYRPHYHZVVNKBB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.96 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|