C43H54N2O4 — CID 162792390
(1R,4R,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162792390) has the molecular formula C43H54N2O4 and a molecular weight of 662.92 g/mol. Its IUPAC name is (1R,4R,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | (1R,4R,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162792390 |
| Molecular Formula | C43H54N2O4 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | (1R,4R,16R,18S,20S)-20-[(2-amino-4-pyridinyl)methyl]-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC[C@H]1C[C@H](Cc2ccnc(N)c2)C[C@H]2C#C[C@H](c3ccccc3CCC(C)C)c3cc(O)c(OC)cc3CCC(=O)CC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C43H54N2O4/c1-5-6-9-29-20-31(21-30-18-19-45-43(44)24-30)22-33-15-17-37(36-11-8-7-10-32(36)13-12-28(2)3)38-27-41(48)42(49-4)25-34(38)14-16-35(46)26-40(47)39(33)23-29/h7-8,10-11,18-19,24-25,27-29,31,33,37,39,48H,5-6,9,12-14,16,20-23,26H2,1-4H3,(H2,44,45)/t29-,31+,33+,37+,39+/m0/s1 |
| InChIKey | BOLSDWRSSPOGJW-CRMLFLAISA-N |
| XLogP | 8.66 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|