C37H48O4 — CID 162846583
(1S,4S,16S,18S)-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione (PubChem CID 162846583) has the molecular formula C37H48O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is (1S,4S,16S,18S)-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione.
| Compound Name | (1S,4S,16S,18S)-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
|---|---|
| PubChem CID | 162846583 |
| Molecular Formula | C37H48O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | (1S,4S,16S,18S)-18-butyl-7-hydroxy-8-methoxy-4-[2-(3-methylbutyl)phenyl]tricyclo[14.5.0.05,10]henicosa-5,7,9-trien-2-yne-13,15-dione |
| SMILES | CCCC[C@H]1CCC[C@@H]2C#C[C@@H](c3ccccc3CCC(C)C)c3cc(O)c(OC)cc3CCC(=O)CC(=O)[C@H]2C1 |
| InChI | InChI=1S/C37H48O4/c1-5-6-10-26-11-9-13-28-18-20-32(31-14-8-7-12-27(31)16-15-25(2)3)33-24-36(40)37(41-4)22-29(33)17-19-30(38)23-35(39)34(28)21-26/h7-8,12,14,22,24-26,28,32,34,40H,5-6,9-11,13,15-17,19,21,23H2,1-4H3/t26-,28+,32-,34-/m0/s1 |
| InChIKey | OPJFSMPYNXJUND-XIIGQTTJSA-N |
| XLogP | 8.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|