C31H36O5 — CID 162876733
10-(2-cyclohexylethyl)-2,8-dihydroxy-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione (PubChem CID 162876733) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is 10-(2-cyclohexylethyl)-2,8-dihydroxy-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione.
| Compound Name | 10-(2-cyclohexylethyl)-2,8-dihydroxy-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione |
|---|---|
| PubChem CID | 162876733 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 10-(2-cyclohexylethyl)-2,8-dihydroxy-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione |
| SMILES | COc1cc2c(cc1O)C(c1ccccc1)C#CCC(CCC1CCCCC1)C(=O)C(O)C(=O)CC2 |
| InChI | InChI=1S/C31H36O5/c1-36-29-19-24-17-18-27(32)31(35)30(34)23(16-15-21-9-4-2-5-10-21)13-8-14-25(26(24)20-28(29)33)22-11-6-3-7-12-22/h3,6-7,11-12,19-21,23,25,31,33,35H,2,4-5,9-10,13,15-18H2,1H3 |
| InChIKey | XICJLTOMORHRDY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|