C30H36O6 — CID 163102578
2,8-dihydroxy-10-[3-(hydroxymethyl)hexyl]-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione (PubChem CID 163102578) has the molecular formula C30H36O6 and a molecular weight of 492.61 g/mol. Its IUPAC name is 2,8-dihydroxy-10-[3-(hydroxymethyl)hexyl]-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione.
| Compound Name | 2,8-dihydroxy-10-[3-(hydroxymethyl)hexyl]-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione |
|---|---|
| PubChem CID | 163102578 |
| Molecular Formula | C30H36O6 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2,8-dihydroxy-10-[3-(hydroxymethyl)hexyl]-3-methoxy-14-phenyl-12,13-didehydro-6,10,11,14-tetrahydro-5H-benzo[12]annulene-7,9-dione |
| SMILES | CCCC(CO)CCC1CC#CC(c2ccccc2)c2cc(O)c(OC)cc2CCC(=O)C(O)C1=O |
| InChI | InChI=1S/C30H36O6/c1-3-8-20(19-31)13-14-22-11-7-12-24(21-9-5-4-6-10-21)25-18-27(33)28(36-2)17-23(25)15-16-26(32)30(35)29(22)34/h4-6,9-10,17-18,20,22,24,30-31,33,35H,3,8,11,13-16,19H2,1-2H3 |
| InChIKey | UNXJTXDPHDJTRL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|