C12H18N2O6 — CID 163139037
[2-butan-2-yl-4,6-bis(dihydroxyamino)phenyl] acetate (PubChem CID 163139037) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is [2-butan-2-yl-4,6-bis(dihydroxyamino)phenyl] acetate.
| Compound Name | [2-butan-2-yl-4,6-bis(dihydroxyamino)phenyl] acetate |
|---|---|
| PubChem CID | 163139037 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [2-butan-2-yl-4,6-bis(dihydroxyamino)phenyl] acetate |
| SMILES | CCC(C)c1cc(N(O)O)cc(N(O)O)c1OC(C)=O |
| InChI | InChI=1S/C12H18N2O6/c1-4-7(2)10-5-9(13(16)17)6-11(14(18)19)12(10)20-8(3)15/h5-7,16-19H,4H2,1-3H3 |
| InChIKey | JBMLIXMERQMUHM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|