C10H6Cl2NO4- — CID 163140213
4,6-dichloro-3-[hydroxy(oxido)amino]-7-methylchromen-2-one (PubChem CID 163140213) has the molecular formula C10H6Cl2NO4- and a molecular weight of 275.07 g/mol. Its IUPAC name is 4,6-dichloro-3-[hydroxy(oxido)amino]-7-methylchromen-2-one.
| Compound Name | 4,6-dichloro-3-[hydroxy(oxido)amino]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 163140213 |
| Molecular Formula | C10H6Cl2NO4- |
| Molecular Weight | 275.07 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 4,6-dichloro-3-[hydroxy(oxido)amino]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)c(N([O-])O)c(Cl)c2cc1Cl |
| InChI | InChI=1S/C10H6Cl2NO4/c1-4-2-7-5(3-6(4)11)8(12)9(13(15)16)10(14)17-7/h2-3,15H,1H3/q-1 |
| InChIKey | CBQGJDGAVRKOLW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.07 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|