C35H43N4O5+ — CID 163143484
1-[3-[[8-(diaminomethyl)-12-hydroxy-2-aza-17-azoniatetracyclo[15.2.1.04,19.06,11]icosa-1(20),2,4(19),6(11),7,9-hexaen-13-yn-16-yl]oxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one (PubChem CID 163143484) has the molecular formula C35H43N4O5+ and a molecular weight of 599.75 g/mol. Its IUPAC name is 1-[3-[[8-(diaminomethyl)-12-hydroxy-2-aza-17-azoniatetracyclo[15.2.1.04,19.06,11]icosa-1(20),2,4(19),6(11),7,9-hexaen-13-yn-16-yl]oxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one.
| Compound Name | 1-[3-[[8-(diaminomethyl)-12-hydroxy-2-aza-17-azoniatetracyclo[15.2.1.04,19.06,11]icosa-1(20),2,4(19),6(11),7,9-hexaen-13-yn-16-yl]oxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one |
|---|---|
| PubChem CID | 163143484 |
| Molecular Formula | C35H43N4O5+ |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 1-[3-[[8-(diaminomethyl)-12-hydroxy-2-aza-17-azoniatetracyclo[15.2.1.04,19.06,11]icosa-1(20),2,4(19),6(11),7,9-hexaen-13-yn-16-yl]oxy]-4-hydroxyphenyl]-5-hydroxydecan-3-one |
| SMILES | CCCCCC(O)CC(=O)CCc1ccc(O)c(OC2CC#CC(O)c3ccc(C(N)N)cc3CC3=C4C[NH+]2C=C4N=C3)c1 |
| InChI | InChI=1S/C35H42N4O5/c1-2-3-4-6-26(40)18-27(41)12-9-22-10-14-32(43)33(15-22)44-34-8-5-7-31(42)28-13-11-23(35(36)37)16-24(28)17-25-19-38-30-21-39(34)20-29(25)30/h10-11,13-16,19,21,26,31,34-35,40,42-43H,2-4,6,8-9,12,17-18,20,36-37H2,1H3/p+1 |
| InChIKey | KRDKRDAMULRMBZ-UHFFFAOYSA-O |
| XLogP | 2.65 |
| TPSA | 155.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|