C37H44N4O6 — CID 163145549
1-[3-[(11-amino-16-hydroxy-2,10,21-triazapentacyclo[19.2.1.04,23.06,15.07,12]tetracosa-1(24),2,4(23),6(15),7(12),13-hexaen-17-yn-20-yl)oxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one (PubChem CID 163145549) has the molecular formula C37H44N4O6 and a molecular weight of 640.78 g/mol. Its IUPAC name is 1-[3-[(11-amino-16-hydroxy-2,10,21-triazapentacyclo[19.2.1.04,23.06,15.07,12]tetracosa-1(24),2,4(23),6(15),7(12),13-hexaen-17-yn-20-yl)oxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one.
| Compound Name | 1-[3-[(11-amino-16-hydroxy-2,10,21-triazapentacyclo[19.2.1.04,23.06,15.07,12]tetracosa-1(24),2,4(23),6(15),7(12),13-hexaen-17-yn-20-yl)oxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
|---|---|
| PubChem CID | 163145549 |
| Molecular Formula | C37H44N4O6 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 1-[3-[(11-amino-16-hydroxy-2,10,21-triazapentacyclo[19.2.1.04,23.06,15.07,12]tetracosa-1(24),2,4(23),6(15),7(12),13-hexaen-17-yn-20-yl)oxy]-4-hydroxyphenyl]-5,7-dihydroxydecan-3-one |
| SMILES | CCCC(O)CC(O)CC(=O)CCc1ccc(O)c(OC2CC#CC(O)c3ccc4c(c3CC3=C5CN2C=C5N=C3)CCNC4N)c1 |
| InChI | InChI=1S/C37H44N4O6/c1-2-4-24(42)17-26(44)18-25(43)9-7-22-8-12-34(46)35(15-22)47-36-6-3-5-33(45)28-10-11-29-27(13-14-39-37(29)38)30(28)16-23-19-40-32-21-41(36)20-31(23)32/h8,10-12,15,19,21,24,26,33,36-37,39,42,44-46H,2,4,6-7,9,13-14,16-18,20,38H2,1H3 |
| InChIKey | LKWOITXLILMGHR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 160.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|