C27H38N2O5 — CID 163175349
5-hydroxy-1-[4-hydroxy-3-[[3-(3-methoxypropyl)-4H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]phenyl]decan-3-one (PubChem CID 163175349) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 5-hydroxy-1-[4-hydroxy-3-[[3-(3-methoxypropyl)-4H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]phenyl]decan-3-one.
| Compound Name | 5-hydroxy-1-[4-hydroxy-3-[[3-(3-methoxypropyl)-4H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]phenyl]decan-3-one |
|---|---|
| PubChem CID | 163175349 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 5-hydroxy-1-[4-hydroxy-3-[[3-(3-methoxypropyl)-4H-pyrrolo[3,4-b]pyrrol-5-yl]methoxy]phenyl]decan-3-one |
| SMILES | CCCCCC(O)CC(=O)CCc1ccc(O)c(OCN2C=C3N=CC(CCCOC)=C3C2)c1 |
| InChI | InChI=1S/C27H38N2O5/c1-3-4-5-8-22(30)15-23(31)11-9-20-10-12-26(32)27(14-20)34-19-29-17-24-21(7-6-13-33-2)16-28-25(24)18-29/h10,12,14,16,18,22,30,32H,3-9,11,13,15,17,19H2,1-2H3 |
| InChIKey | XALNRWYALIBVNK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|