C28H38N2O4 — CID 163128363
9-cyclohexyl-5-hydroxy-1-[4-hydroxy-3-(6H-pyrrolo[3,4-b]pyrrol-5-ylmethoxy)phenyl]nonan-3-one (PubChem CID 163128363) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is 9-cyclohexyl-5-hydroxy-1-[4-hydroxy-3-(6H-pyrrolo[3,4-b]pyrrol-5-ylmethoxy)phenyl]nonan-3-one.
| Compound Name | 9-cyclohexyl-5-hydroxy-1-[4-hydroxy-3-(6H-pyrrolo[3,4-b]pyrrol-5-ylmethoxy)phenyl]nonan-3-one |
|---|---|
| PubChem CID | 163128363 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 9-cyclohexyl-5-hydroxy-1-[4-hydroxy-3-(6H-pyrrolo[3,4-b]pyrrol-5-ylmethoxy)phenyl]nonan-3-one |
| SMILES | O=C(CCc1ccc(O)c(OCN2C=C3C=CN=C3C2)c1)CC(O)CCCCC1CCCCC1 |
| InChI | InChI=1S/C28H38N2O4/c31-24(9-5-4-8-21-6-2-1-3-7-21)17-25(32)12-10-22-11-13-27(33)28(16-22)34-20-30-18-23-14-15-29-26(23)19-30/h11,13-16,18,21,24,31,33H,1-10,12,17,19-20H2 |
| InChIKey | FDWYKSLGKGIFTA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 82.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|