C20H26F3N3O4 — CID 163143552
methyl 3-[(2S,5aS,8aS)-1-methyl-5-oxo-6-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate (PubChem CID 163143552) has the molecular formula C20H26F3N3O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is methyl 3-[(2S,5aS,8aS)-1-methyl-5-oxo-6-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,5aS,8aS)-1-methyl-5-oxo-6-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
|---|---|
| PubChem CID | 163143552 |
| Molecular Formula | C20H26F3N3O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | methyl 3-[(2S,5aS,8aS)-1-methyl-5-oxo-6-[[3-(trifluoromethoxy)phenyl]methyl]-3,4,5a,7,8,8a-hexahydro-2H-pyrrolo[3,2-e][1,4]diazepin-2-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1CNC(=O)[C@@H]2[C@H](CCN2Cc2cccc(OC(F)(F)F)c2)N1C |
| InChI | InChI=1S/C20H26F3N3O4/c1-25-14(6-7-17(27)29-2)11-24-19(28)18-16(25)8-9-26(18)12-13-4-3-5-15(10-13)30-20(21,22)23/h3-5,10,14,16,18H,6-9,11-12H2,1-2H3,(H,24,28)/t14-,16-,18-/m0/s1 |
| InChIKey | KRQFQSGVIAXWHW-ZVZYQTTQSA-N |
| XLogP | 1.91 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |