C16H21NO4 — CID 163144448
(6R,7aS)-3a-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]-1,2,3,6,7,7a-hexahydroindol-6-ol (PubChem CID 163144448) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (6R,7aS)-3a-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]-1,2,3,6,7,7a-hexahydroindol-6-ol.
| Compound Name | (6R,7aS)-3a-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]-1,2,3,6,7,7a-hexahydroindol-6-ol |
|---|---|
| PubChem CID | 163144448 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (6R,7aS)-3a-[4-hydroxy-2-(hydroxymethyl)-5-methoxyphenyl]-1,2,3,6,7,7a-hexahydroindol-6-ol |
| SMILES | COc1cc(C23C=C[C@H](O)C[C@@H]2NCC3)c(CO)cc1O |
| InChI | InChI=1S/C16H21NO4/c1-21-14-8-12(10(9-18)6-13(14)20)16-3-2-11(19)7-15(16)17-5-4-16/h2-3,6,8,11,15,17-20H,4-5,7,9H2,1H3/t11-,15-,16?/m0/s1 |
| InChIKey | KZWDINOJDLOCCZ-QUJPKXGGSA-N |
| XLogP | 0.81 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|