C18H25NO3 — CID 176591959
(3aR,6S,7aS)-3a-(3,4-diethoxyphenyl)-1,2,3,6,7,7a-hexahydroindol-6-ol (PubChem CID 176591959) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (3aR,6S,7aS)-3a-(3,4-diethoxyphenyl)-1,2,3,6,7,7a-hexahydroindol-6-ol.
| Compound Name | (3aR,6S,7aS)-3a-(3,4-diethoxyphenyl)-1,2,3,6,7,7a-hexahydroindol-6-ol |
|---|---|
| PubChem CID | 176591959 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (3aR,6S,7aS)-3a-(3,4-diethoxyphenyl)-1,2,3,6,7,7a-hexahydroindol-6-ol |
| SMILES | CCOc1ccc([C@@]23C=C[C@@H](O)C[C@@H]2NCC3)cc1OCC |
| InChI | InChI=1S/C18H25NO3/c1-3-21-15-6-5-13(11-16(15)22-4-2)18-8-7-14(20)12-17(18)19-10-9-18/h5-8,11,14,17,19-20H,3-4,9-10,12H2,1-2H3/t14-,17+,18+/m1/s1 |
| InChIKey | IUDBNMNNDOCIBF-JLSDUUJJSA-N |
| XLogP | 2.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|