C25H35N3O5 — CID 163148569
4-[4-[[(1R,3S,4R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163148569) has the molecular formula C25H35N3O5 and a molecular weight of 457.57 g/mol. Its IUPAC name is 4-[4-[[(1R,3S,4R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[4-[[(1R,3S,4R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163148569 |
| Molecular Formula | C25H35N3O5 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[4-[[(1R,3S,4R,8R,10R,14S)-10,14-dimethyl-6-oxo-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-5-yl]methyl]piperazin-1-yl]-N-hydroxybenzeneamine oxide |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)C(CN4CCN(c5ccc([NH+]([O-])O)cc5)CC4)[C@H]3[C@@H]3O[C@@]132 |
| InChI | InChI=1S/C25H35N3O5/c1-16-4-3-9-24(2)14-20-21(22-25(16,24)33-22)19(23(29)32-20)15-26-10-12-27(13-11-26)17-5-7-18(8-6-17)28(30)31/h5-8,16,19-22,28,30H,3-4,9-15H2,1-2H3/t16-,19?,20+,21+,22-,24+,25-/m0/s1 |
| InChIKey | MMFCAWXTTNQKEL-IJQZVVLCSA-N |
| XLogP | 1.74 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|