C25H32Cl2N2O3 — CID 3255252
5-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 3255252) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is 5-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | 5-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 3255252 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 5-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | CC1CCCC2(C)CC3OC(=O)C(CN4CCN(c5ccc(Cl)c(Cl)c5)CC4)C3C3OC132 |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-15-4-3-7-24(2)13-20-21(22-25(15,24)32-22)17(23(30)31-20)14-28-8-10-29(11-9-28)16-5-6-18(26)19(27)12-16/h5-6,12,15,17,20-22H,3-4,7-11,13-14H2,1-2H3 |
| InChIKey | QNAZEXBNVJKWBQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|