C26H36N2O4 — CID 6570680
(1R,3S,4R,5S,8R,10R,14S)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 6570680) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is (1R,3S,4R,5S,8R,10R,14S)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | (1R,3S,4R,5S,8R,10R,14S)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 6570680 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | (1R,3S,4R,5S,8R,10R,14S)-5-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | COc1ccc(N2CCN(C[C@H]3C(=O)O[C@@H]4C[C@@]5(C)CCC[C@H](C)[C@@]56O[C@H]6[C@@H]43)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O4/c1-17-5-4-10-25(2)15-21-22(23-26(17,25)32-23)20(24(29)31-21)16-27-11-13-28(14-12-27)18-6-8-19(30-3)9-7-18/h6-9,17,20-23H,4-5,10-16H2,1-3H3/t17-,20+,21+,22+,23-,25+,26-/m0/s1 |
| InChIKey | PRAIGGPCHKMTSE-XSWJKVCQSA-N |
| XLogP | 3.34 |
| TPSA | 54.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|