C15H4Cl4NO5- — CID 163150396
1,2,3,4-tetrachloro-6-formyl-10-hydroxy-5-nitroanthracen-9-olate (PubChem CID 163150396) has the molecular formula C15H4Cl4NO5- and a molecular weight of 420.01 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-6-formyl-10-hydroxy-5-nitroanthracen-9-olate.
| Compound Name | 1,2,3,4-tetrachloro-6-formyl-10-hydroxy-5-nitroanthracen-9-olate |
|---|---|
| PubChem CID | 163150396 |
| Molecular Formula | C15H4Cl4NO5- |
| Molecular Weight | 420.01 g/mol |
| Exact Mass | 417.88 |
| IUPAC Name | 1,2,3,4-tetrachloro-6-formyl-10-hydroxy-5-nitroanthracen-9-olate |
| SMILES | O=Cc1ccc2c([O-])c3c(Cl)c(Cl)c(Cl)c(Cl)c3c(O)c2c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H5Cl4NO5/c16-9-7-8(10(17)12(19)11(9)18)15(23)6-5(14(7)22)2-1-4(3-21)13(6)20(24)25/h1-3,22-23H/p-1 |
| InChIKey | YBOODVSIWYYFPW-UHFFFAOYSA-M |
| XLogP | 5.11 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.01 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|