About ethane;3-methyl-2-nitrobenzaldehyde;propane
ethane;3-methyl-2-nitrobenzaldehyde;propane (PubChem CID 165131834) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is ethane;3-methyl-2-nitrobenzaldehyde;propane.
Molecular Properties
| Compound Name | ethane;3-methyl-2-nitrobenzaldehyde;propane |
| PubChem CID | 165131834 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethane;3-methyl-2-nitrobenzaldehyde;propane |
| SMILES | CC.CCC.Cc1cccc(C=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H7NO3.C3H8.C2H6/c1-6-3-2-4-7(5-10)8(6)9(11)12;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | TUUMCHQJYHHANW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-2-nitrobenzaldehyde;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2-nitrobenzaldehyde;propane?
The IUPAC name of ethane;3-methyl-2-nitrobenzaldehyde;propane (CID 165131834) is ethane;3-methyl-2-nitrobenzaldehyde;propane.
What is the SMILES notation for ethane;3-methyl-2-nitrobenzaldehyde;propane?
The canonical SMILES for ethane;3-methyl-2-nitrobenzaldehyde;propane is CC.CCC.Cc1cccc(C=O)c1[N+](=O)[O-].
What is the InChIKey of ethane;3-methyl-2-nitrobenzaldehyde;propane?
The InChIKey is TUUMCHQJYHHANW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C3H8.C2H6/c1-6-3-2-4-7(5-10)8(6)9(11)12;1-3-2;1-2/h2-5H,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-methyl-2-nitrobenzaldehyde;propane?
ethane;3-methyl-2-nitrobenzaldehyde;propane has a molecular weight of 239.31 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2-nitrobenzaldehyde;propane is sourced from PubChem (CID 165131834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).