C38H63N3O6 — CID 163158726
[5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163158726) has the molecular formula C38H63N3O6 and a molecular weight of 657.94 g/mol. Its IUPAC name is [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163158726 |
| Molecular Formula | C38H63N3O6 |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 657.47 |
| IUPAC Name | [5-ethyl-2-(ethylamino)cyclohexyl]methyl 7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCNC1CCC(CC)CC1COC(=O)C12OC1(CC(CO)=C(C)CCC1CCNC(N)C1)C(=O)C1CCCC(CC(C)C)C1C2=O |
| InChI | InChI=1S/C38H63N3O6/c1-6-25-13-14-31(40-7-2)28(18-25)22-46-36(45)38-35(44)33-27(17-23(3)4)9-8-10-30(33)34(43)37(38,47-38)20-29(21-42)24(5)11-12-26-15-16-41-32(39)19-26/h23,25-28,30-33,40-42H,6-22,39H2,1-5H3 |
| InChIKey | JCTKGZLFFPNWNS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|