C33H54N2O6 — CID 163155621
hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163155621) has the molecular formula C33H54N2O6 and a molecular weight of 574.80 g/mol. Its IUPAC name is hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163155621 |
| Molecular Formula | C33H54N2O6 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.40 |
| IUPAC Name | hexyl (1aS,7aR)-7a-[5-(2-aminopiperidin-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-3-(2-methylpropyl)-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CCCCCCOC(=O)[C@]12O[C@@]1(CC(CO)=C(C)CCC1CCNC(N)C1)C(=O)C1CCCC(CC(C)C)C1C2=O |
| InChI | InChI=1S/C33H54N2O6/c1-5-6-7-8-16-40-31(39)33-30(38)28-24(17-21(2)3)10-9-11-26(28)29(37)32(33,41-33)19-25(20-36)22(4)12-13-23-14-15-35-27(34)18-23/h21,23-24,26-28,35-36H,5-20,34H2,1-4H3/t23?,24?,26?,27?,28?,32-,33-/m0/s1 |
| InChIKey | YZUIKSBLZAHBJC-JFDULTOVSA-N |
| XLogP | 4.61 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|