C30H46N2O7 — CID 163150607
2-hydroxyethyl (1aS,7aR)-7a-[4-[1-(2-aminopiperidin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163150607) has the molecular formula C30H46N2O7 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-hydroxyethyl (1aS,7aR)-7a-[4-[1-(2-aminopiperidin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | 2-hydroxyethyl (1aS,7aR)-7a-[4-[1-(2-aminopiperidin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163150607 |
| Molecular Formula | C30H46N2O7 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 2-hydroxyethyl (1aS,7aR)-7a-[4-[1-(2-aminopiperidin-4-yl)cyclohexyl]-2-(hydroxymethyl)-3-methylbut-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CC(CC1(C2CCNC(N)C2)CCCCC1)=C(CO)C[C@@]12O[C@]1(C(=O)OCCO)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C30H46N2O7/c1-19(16-28(10-5-2-6-11-28)21-9-12-32-24(31)15-21)20(18-34)17-29-25(35)22-7-3-4-8-23(22)26(36)30(29,39-29)27(37)38-14-13-33/h21-24,32-34H,2-18,31H2,1H3/t21?,22?,23?,24?,29-,30-/m0/s1 |
| InChIKey | FKDFFCDCQJXMJF-PDYHMPORSA-N |
| XLogP | 2.31 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|