C29H45N2O6+ — CID 163121006
cyclohexyl 7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163121006) has the molecular formula C29H45N2O6+ and a molecular weight of 517.69 g/mol. Its IUPAC name is cyclohexyl 7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | cyclohexyl 7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163121006 |
| Molecular Formula | C29H45N2O6+ |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | cyclohexyl 7a-[5-(2-aminopiperidin-1-ium-4-yl)-2-(hydroxymethyl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CC(CCC1CC[NH2+]C(N)C1)=C(CO)CC12OC1(C(=O)OC1CCCCC1)C(=O)C1CCCCC1C2=O |
| InChI | InChI=1S/C29H44N2O6/c1-18(11-12-19-13-14-31-24(30)15-19)20(17-32)16-28-25(33)22-9-5-6-10-23(22)26(34)29(28,37-28)27(35)36-21-7-3-2-4-8-21/h19,21-24,31-32H,2-17,30H2,1H3/p+1 |
| InChIKey | AOWUBOGZABCPEX-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|