C27H41N2O5+ — CID 163133304
cyclopentyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate (PubChem CID 163133304) has the molecular formula C27H41N2O5+ and a molecular weight of 473.63 g/mol. Its IUPAC name is cyclopentyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate.
| Compound Name | cyclopentyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
|---|---|
| PubChem CID | 163133304 |
| Molecular Formula | C27H41N2O5+ |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | cyclopentyl (1aS,7aR)-7a-[5-(2-aminopiperidin-1-ium-4-yl)-3-methylpent-2-enyl]-2,7-dioxo-2a,3,4,5,6,6a-hexahydronaphtho[2,3-b]oxirene-1a-carboxylate |
| SMILES | CC(=CC[C@@]12O[C@]1(C(=O)OC1CCCC1)C(=O)C1CCCCC1C2=O)CCC1CC[NH2+]C(N)C1 |
| InChI | InChI=1S/C27H40N2O5/c1-17(10-11-18-13-15-29-22(28)16-18)12-14-26-23(30)20-8-4-5-9-21(20)24(31)27(26,34-26)25(32)33-19-6-2-3-7-19/h12,18-22,29H,2-11,13-16,28H2,1H3/p+1/t18?,20?,21?,22?,26-,27-/m0/s1 |
| InChIKey | GBWYANWZYLHNNO-XHTHRNGZSA-O |
| XLogP | 2.31 |
| TPSA | 115.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|